![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| unwilling antagonist.nsf | 2008-07-05 12:30 | 32K | |
| uimother.nsf | 2008-07-05 12:30 | 32K | |
| turbo.nsf | 2008-07-05 12:30 | 32K | |
| troubled dreams.nsf | 2008-07-05 12:30 | 32K | |
| trancelvania 2.nsf | 2008-07-05 12:29 | 24K | |
| trancelvania.nsf | 2008-07-05 12:29 | 32K | |
| tits of terrorists.nsf | 2008-07-05 12:29 | 32K | |
| throw that weight around.nsf | 2008-07-05 12:29 | 24K | |
| the spy who shat on me.nsf | 2008-07-05 12:29 | 24K | |
| the society of nonconformists.nsf | 2008-07-05 12:29 | 32K | |
| the rush dance adaptor.nsf | 2008-07-05 12:29 | 32K | |
| the last level.nsf | 2008-07-05 12:29 | 24K | |
| the hidden answer.nsf | 2008-07-05 12:29 | 32K | |
| the final conflict.nsf | 2008-07-05 12:29 | 32K | |
| the battle continues.nsf | 2008-07-05 12:29 | 32K | |
| tetris - tetritechno.nsf | 2008-07-05 12:29 | 32K | |
| terra's lament.nsf | 2008-07-05 12:29 | 32K | |
| tax evasion.nsf | 2008-07-05 12:29 | 24K | |
| stup0nd0rzed.nsf | 2008-07-05 12:29 | 32K | |
| stratosphere.nsf | 2008-07-05 12:29 | 8.0K | |
| storytime.nsf | 2008-07-05 12:29 | 24K | |
| storm eagle redux.nsf | 2008-07-05 12:29 | 24K | |
| still afraid of darkness 8k remix.nsf | 2008-07-05 12:29 | 8.0K | |
| still afraid of darkness.nsf | 2008-07-05 12:29 | 8.0K | |
| solfeggio in c minor.nsf | 2008-07-05 12:29 | 8.0K | |
| shiftyworld.nsf | 2008-07-05 12:29 | 32K | |
| sega logo.nsf | 2008-07-05 12:29 | 24K | |
| secrets and lies.nsf | 2008-07-05 12:29 | 24K | |
| sea of memories.nsf | 2008-07-05 12:29 | 24K | |
| rockit.nsf | 2008-07-05 12:29 | 32K | |
| quickman rave.nsf | 2008-07-05 12:29 | 24K | |
| premonition.nsf | 2008-07-05 12:29 | 32K | |
| premenition.nsf | 2008-07-05 12:29 | 32K | |
| overdrive.nsf | 2008-07-05 12:29 | 32K | |
| overdrive!.nsf | 2008-07-05 12:29 | 32K | |
| out of reach.nsf | 2008-07-05 12:29 | 32K | |
| one man and his droid.nsf | 2008-07-05 12:29 | 8.0K | |
| nut harvesters.nsf | 2008-07-05 12:29 | 24K | |
| noxious.nsf | 2008-07-05 12:29 | 24K | |
| nocturnal wishes.nsf | 2008-07-05 12:29 | 32K | |
| need for speed 2 - sirius.nsf | 2008-07-05 12:29 | 24K | |
| nebula.nsf | 2008-07-05 12:29 | 24K | |
| mm6 select.nsf | 2008-07-05 12:29 | 24K | |
| metroid prime - chozo sacred chiptune.nsf | 2008-07-05 12:29 | 24K | |
| medusa - shattered glyph mix.nsf | 2008-07-05 12:29 | 32K | |
| marble zone.nsf | 2008-07-05 12:29 | 24K | |
| manoria cathedral.nsf | 2008-07-05 12:29 | 8.0K | |
| luminosity and viscosity.nsf | 2008-07-05 12:29 | 32K | |
| konamized.nsf | 2008-07-05 12:29 | 32K | |
| konami's moon base.nsf | 2008-07-05 12:29 | 32K | |
| jag minns inte.nsf | 2008-07-05 12:29 | 24K | |
| jag minns inte - remix.nsf | 2008-07-05 12:29 | 24K | |
| into wilys fortress.nsf | 2008-07-05 12:29 | 32K | |
| insurrection.nsf | 2008-07-05 12:29 | 24K | |
| inspirational doorknob.nsf | 2008-07-05 12:29 | 24K | |
| infected mushroom - bust a move revamp.nsf | 2008-07-05 12:29 | 24K | |
| infected mushroom - bust a move.nsf | 2008-07-05 12:29 | 24K | |
| home bay.nsf | 2008-07-05 12:29 | 32K | |
| hawkeye - eye of the predator.nsf | 2008-07-05 12:29 | 32K | |
| haunted dance.nsf | 2008-07-05 12:29 | 16K | |
| grim determination.nsf | 2008-07-05 12:29 | 32K | |
| giant monster city lunch.nsf | 2008-07-05 12:29 | 32K | |
| fx1.nsf | 2008-07-05 12:29 | 24K | |
| final fantasy - prelude.nsf | 2008-07-05 12:29 | 24K | |
| final boss theme (exp).nsf | 2008-07-05 12:29 | 24K | |
| fast break.nsf | 2008-07-05 12:29 | 24K | |
| f-zero - big blue.nsf | 2008-07-05 12:29 | 8.0K | |
| eye of the predator.nsf | 2008-07-05 12:29 | 32K | |
| exam cram.nsf | 2008-07-05 12:29 | 32K | |
| ekans desert.nsf | 2008-07-05 12:29 | 24K | |
| effect.nsf | 2008-07-05 12:29 | 20K | |
| ecco the dolphin 2 - home bay.nsf | 2008-07-05 12:29 | 32K | |
| ducktales - trancelvania.nsf | 2008-07-05 12:29 | 32K | |
| drift.nsf | 2008-07-05 12:29 | 24K | |
| desert war.nsf | 2008-07-05 12:29 | 32K | |
| dementia.nsf | 2008-07-05 12:29 | 24K | |
| deep space dance.nsf | 2008-07-05 12:29 | 32K | |
| dark waters.nsf | 2008-07-05 12:29 | 8.0K | |
| cruzzazzay.nsf | 2008-07-05 12:29 | 24K | |
| cq boss konami mix.nsf | 2008-07-05 12:29 | 24K | |
| cq boss.nsf | 2008-07-05 12:29 | 24K | |
| coop-Kwix/ | 2008-07-05 12:30 | - | |
| conflict of interest.nsf | 2008-07-05 12:29 | 24K | |
| computer.nsf | 2008-07-05 12:29 | 24K | |
| classical mushroom update.nsf | 2008-07-05 12:29 | 88K | |
| classical mushroom.nsf | 2008-07-05 12:29 | 32K | |
| chrono trigger - manoria cathedral.nsf | 2008-07-05 12:29 | 8.0K | |
| boss selected.nsf | 2008-07-05 12:29 | 24K | |
| boss select.nsf | 2008-07-05 12:29 | 24K | |
| boss.nsf | 2008-07-05 12:29 | 24K | |
| bloody hell.nsf | 2008-07-05 12:29 | 24K | |
| biologic spearmint.nsf | 2008-07-05 12:29 | 32K | |
| beatbraked.nsf | 2008-07-05 12:29 | 32K | |
| battle with the betrayed.nsf | 2008-07-05 12:29 | 24K | |
| apocalypse please.nsf | 2008-07-05 12:29 | 32K | |
| almost there.nsf | 2008-07-05 12:29 | 24K | |
| alkali earth.nsf | 2008-07-05 12:29 | 29K | |
| against overwhelming odds.nsf | 2008-07-05 12:29 | 32K | |
| afraid of darkness.nsf | 2008-07-05 12:29 | 24K | |
| aerial assault.nsf | 2008-07-05 12:29 | 24K | |
| action hero select.nsf | 2008-07-05 12:29 | 24K | |
| absolution.nsf | 2008-07-05 12:29 | 32K | |
| 1-[x]-0.nsf | 2008-07-05 12:29 | 32K | |