![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | 18 - game over!.spc | 2019-08-24 07:18 | 65K | |
| 19 - king jewel box.spc | 2019-08-24 07:18 | 65K | |
| 24 - cursed!.spc | 2019-08-24 07:18 | 65K | |
| 25 - curse solved.spc | 2019-08-24 07:18 | 65K | |
| 01 - torneco fanfare.spc | 2019-08-24 07:18 | 65K | |
| 16 - level up!.spc | 2019-08-24 07:18 | 65K | |
| 17 - good night.spc | 2019-08-24 07:18 | 65K | |
| 21 - awakening.spc | 2019-08-24 07:18 | 65K | |
| 22 - monster's lair discovered!.spc | 2019-08-24 07:18 | 65K | |
| 27 - box of happiness.spc | 2019-08-24 07:18 | 65K | |
| 05 - entering the dungeon.spc | 2019-08-24 07:18 | 65K | |
| 06 - sandy caves.spc | 2019-08-24 07:18 | 65K | |
| 07 - wooden structure.spc | 2019-08-24 07:18 | 65K | |
| 08 - limestone quarry.spc | 2019-08-24 07:18 | 65K | |
| 09 - muddy tunnels.spc | 2019-08-24 07:18 | 65K | |
| 10 - abandoned mine.spc | 2019-08-24 07:18 | 65K | |
| 11 - ancient cave.spc | 2019-08-24 07:18 | 65K | |
| 12 - desolate ice layer.spc | 2019-08-24 07:18 | 65K | |
| 13 - volcanic zone.spc | 2019-08-24 07:18 | 65K | |
| 14 - lava cavern.spc | 2019-08-24 07:18 | 65K | |
| 15 - crystal springs.spc | 2019-08-24 07:18 | 65K | |
| 26 - nene's bar.spc | 2019-08-24 07:18 | 65K | |
| 02 - torneco's theme.spc | 2019-08-24 07:18 | 65K | |
| 03 - treasure hunt.spc | 2019-08-24 07:18 | 65K | |
| 04 - master hunter list.spc | 2019-08-24 07:18 | 65K | |
| 20 - return home.spc | 2019-08-24 07:18 | 65K | |
| 23 - inside the monster's lair.spc | 2019-08-24 07:18 | 65K | |
| 28 - eternal happiness.spc | 2019-08-24 07:18 | 65K | |
|
|---|