![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | 101 - title.spc | 2019-08-24 07:17 | 65K | |
| 102 - basaraou's theme.spc | 2019-08-24 07:17 | 65K | |
| 103 - overture.spc | 2019-08-24 07:17 | 65K | |
| 104 - a crisis is drawing near.spc | 2019-08-24 07:17 | 65K | |
| 105 - hindering ogres.spc | 2019-08-24 07:17 | 65K | |
| 106 - karura's theme.spc | 2019-08-24 07:17 | 65K | |
| 107 - long-standing rival.spc | 2019-08-24 07:17 | 65K | |
| 108 - sennin's theme.spc | 2019-08-24 07:17 | 65K | |
| 109 - momotarou's firm decision.spc | 2019-08-24 07:17 | 65K | |
| 110 - peaceful village.spc | 2019-08-24 07:17 | 65K | |
| 111 - momotarou's theme.spc | 2019-08-24 07:17 | 65K | |
| 112 - battle with ogres.spc | 2019-08-24 07:17 | 65K | |
| 113 - ksitigarbha.spc | 2019-08-24 07:17 | 65K | |
| 114 - training.spc | 2019-08-24 07:17 | 65K | |
| 115 - cave.spc | 2019-08-24 07:17 | 65K | |
| 116 - dreadful enemies.spc | 2019-08-24 07:17 | 65K | |
| 117 - breaking down.spc | 2019-08-24 07:17 | 65K | |
| 118 - sparrows inn.spc | 2019-08-24 07:17 | 65K | |
| 119 - mountain path.spc | 2019-08-24 07:17 | 65K | |
| 120 - desperate situation.spc | 2019-08-24 07:17 | 65K | |
| 121 - ajase's theme.spc | 2019-08-24 07:17 | 65K | |
| 122 - taoist village.spc | 2019-08-24 07:17 | 65K | |
| 123 - rustic fete.spc | 2019-08-24 07:17 | 65K | |
| 124 - moukarimakka ondo.spc | 2019-08-24 07:17 | 65K | |
| 125 - urashima village.spc | 2019-08-24 07:17 | 65K | |
| 126 - ryuuguu castle.spc | 2019-08-24 07:17 | 65K | |
| 127 - ryuuguu millenary dance.spc | 2019-08-24 07:17 | 65K | |
| 128 - kaguya, the princess of the moon.spc | 2019-08-24 07:17 | 65K | |
| 129 - village on the moon.spc | 2019-08-24 07:17 | 65K | |
| 130 - soaring tower.spc | 2019-08-24 07:17 | 65K | |
| 131 - smiling competition.spc | 2019-08-24 07:17 | 65K | |
| 132 - binbougami's theme.spc | 2019-08-24 07:17 | 65K | |
| 133 - amanojyaku's theme.spc | 2019-08-24 07:17 | 65K | |
| 134 - village of smiles.spc | 2019-08-24 07:17 | 65K | |
| 135 - mashira's theme.spc | 2019-08-24 07:17 | 65K | |
| 136 - conversion.spc | 2019-08-24 07:17 | 65K | |
| 137 - capital of wishes.spc | 2019-08-24 07:17 | 65K | |
| 201 - momotarou's castle.spc | 2019-08-24 07:17 | 65K | |
| 202 - fuujin and raijin.spc | 2019-08-24 07:17 | 65K | |
| 203 - yashahime's theme.spc | 2019-08-24 07:17 | 65K | |
| 204 - triumphant return.spc | 2019-08-24 07:17 | 65K | |
| 205 - sea breeze.spc | 2019-08-24 07:17 | 65K | |
| 206 - stormy naval battle.spc | 2019-08-24 07:17 | 65K | |
| 207 - robot making craftsman.spc | 2019-08-24 07:17 | 65K | |
| 208 - fling castle.spc | 2019-08-24 07:17 | 65K | |
| 209 - the ocean floor.spc | 2019-08-24 07:17 | 65K | |
| 210 - milky way.spc | 2019-08-24 07:17 | 65K | |
| 211 - fling in moonlight.spc | 2019-08-24 07:17 | 65K | |
| 212 - phoenix.spc | 2019-08-24 07:17 | 65K | |
| 213 - through a wilderness.spc | 2019-08-24 07:17 | 65K | |
| 214 - hell.spc | 2019-08-24 07:17 | 65K | |
| 215 - decisive battle with basaraou.spc | 2019-08-24 07:17 | 65K | |
| 216 - final battle.spc | 2019-08-24 07:17 | 65K | |
| 217 - dawn.spc | 2019-08-24 07:17 | 65K | |
| 218 - denouement.spc | 2019-08-24 07:17 | 65K | |
| battle end.spc | 2019-08-24 07:17 | 65K | |
| battle intro.spc | 2019-08-24 07:17 | 65K | |
| curse.spc | 2019-08-24 07:17 | 65K | |
| event item.spc | 2019-08-24 07:17 | 65K | |
| failure.spc | 2019-08-24 07:17 | 65K | |
| karura's metamorphosis.spc | 2019-08-24 07:17 | 65K | |
| level up.spc | 2019-08-24 07:17 | 65K | |
| sea.spc | 2019-08-24 07:17 | 65K | |
| technique.spc | 2019-08-24 07:17 | 65K | |
|
|---|