![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | 01 - main theme.spc | 2019-08-24 07:17 | 65K | |
| 02 - outside club x.spc | 2019-08-24 07:17 | 65K | |
| 03 - inside club x.spc | 2019-08-24 07:17 | 65K | |
| 04 - secret concert room.spc | 2019-08-24 07:17 | 65K | |
| 05 - aerosmith's dressing room.spc | 2019-08-24 07:17 | 65K | |
| 06 - non helicopter pursuit.spc | 2019-08-24 07:17 | 65K | |
| 07 - the amazon jungle.spc | 2019-08-24 07:17 | 65K | |
| 08 - evergreen chemical.spc | 2019-08-24 07:17 | 65K | |
| 09 - the elevator.spc | 2019-08-24 07:17 | 65K | |
| 10 - the middle east.spc | 2019-08-24 07:17 | 65K | |
| 11 - kemmytech factory.spc | 2019-08-24 07:17 | 65K | |
| 13 - the rock 'n roll concert.spc | 2019-08-24 07:17 | 65K | |
| begin game.spc | 2019-08-24 07:17 | 65K | |
| destroy kemmytech!.spc | 2019-08-24 07:17 | 65K | |
| explosion.spc | 2019-08-24 07:17 | 65K | |
| glass break.spc | 2019-08-24 07:17 | 65K | |
| if you're watching this.spc | 2019-08-24 07:17 | 65K | |
| it's a front for the new order!.spc | 2019-08-24 07:17 | 65K | |
| it's up to you now.spc | 2019-08-24 07:17 | 65K | |
| kill enemy.spc | 2019-08-24 07:17 | 65K | |
| looks like you made it!.spc | 2019-08-24 07:17 | 65K | |
| press start title screen.spc | 2019-08-24 07:17 | 65K | |
| remember.spc | 2019-08-24 07:17 | 65K | |
| select option title screen.spc | 2019-08-24 07:17 | 65K | |
| stop the new order bus!.spc | 2019-08-24 07:17 | 65K | |
| tear down the wall!.spc | 2019-08-24 07:17 | 65K | |
| these guys are maggots.spc | 2019-08-24 07:17 | 65K | |
|
|---|