![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 38k/ | 2018-01-02 16:06 | - | |
| 1943/ | 2018-01-02 16:06 | - | |
| 1943 Kai/ | 2018-01-02 16:06 | - | |
| A-Train/ | 2018-01-02 16:06 | - | |
| Advfan/ | 2018-01-02 16:06 | - | |
| After Burner/ | 2018-01-02 16:06 | - | |
| After Burner 2 (Arcade)/ | 2018-01-02 16:06 | - | |
| Ajax/ | 2018-01-02 16:06 | - | |
| Akumajou Densetsu (MSX)/ | 2018-01-02 16:06 | - | |
| Akumajou Densetsu/ | 2018-01-02 16:06 | - | |
| Akumajou Dracula (Arcade)/ | 2018-01-02 16:06 | - | |
| Akumajou Dracula (MSX)/ | 2018-01-02 16:06 | - | |
| Akumajou Dracula (X68)/ | 2018-01-02 16:06 | - | |
| Akumajou Dracula 2 (X68)/ | 2018-01-02 16:06 | - | |
| Alex Kidd - The Lost Stars/ | 2018-01-02 16:06 | - | |
| Altered Beast/ | 2018-01-02 16:06 | - | |
| Angelus/ | 2018-01-02 16:06 | - | |
| Antarctic Adventure/ | 2018-01-02 16:06 | - | |
| Aoki Ookami - Genchou Hishi/ | 2018-01-02 16:06 | - | |
| Aoki Ookami - Genghis Khan/ | 2018-01-02 16:06 | - | |
| Aquales/ | 2018-01-02 16:06 | - | |
| Arcus/ | 2018-01-02 16:06 | - | |
| Ares No Tsubasa/ | 2018-01-02 16:06 | - | |
| Arkanoid/ | 2018-01-02 16:06 | - | |
| Aso/ | 2018-01-02 16:06 | - | |
| Assault/ | 2018-01-02 16:06 | - | |
| Asteka 2/ | 2018-01-02 16:06 | - | |
| Asuka 120/ | 2018-01-02 16:06 | - | |
| B-Wing/ | 2018-01-02 16:06 | - | |
| Baraduke/ | 2018-01-02 16:06 | - | |
| Battle Garegga/ | 2018-01-02 16:06 | - | |
| Bokosuka Wars/ | 2018-01-02 16:06 | - | |
| Bomb Jack/ | 2018-01-02 16:06 | - | |
| Bomberman/ | 2018-01-02 16:06 | - | |
| Bomberman 2/ | 2018-01-02 16:06 | - | |
| Bosconian/ | 2018-01-02 16:06 | - | |
| Brentonne Lays/ | 2018-01-02 16:06 | - | |
| Bubble Bobble/ | 2018-01-02 16:06 | - | |
| Burai/ | 2018-01-02 16:06 | - | |
| Burning Force/ | 2018-01-02 16:06 | - | |
| Cameltry/ | 2018-01-02 16:06 | - | |
| Casablanca Ni Ai O/ | 2018-01-02 16:06 | - | |
| Cha Cha Cha/ | 2018-01-02 16:06 | - | |
| Chack'N Pop/ | 2018-01-02 16:06 | - | |
| Challenger/ | 2018-01-02 16:06 | - | |
| Championship Lode Runner/ | 2018-01-02 16:06 | - | |
| Chase HQ/ | 2018-01-02 16:06 | - | |
| Chelnov/ | 2018-01-02 16:06 | - | |
| Chou Rensha/ | 2018-01-02 16:06 | - | |
| Christmas/ | 2018-01-02 16:06 | - | |
| Clu Clu Land/ | 2018-01-02 16:06 | - | |
| Co2jin/ | 2018-01-02 16:06 | - | |
| Cockpit/ | 2018-01-02 16:06 | - | |
| Contra/ | 2018-01-02 16:06 | - | |
| Crazy Climber/ | 2018-01-02 16:06 | - | |
| Cuebrick/ | 2018-01-02 16:06 | - | |
| Dai Ressha Goutou/ | 2018-01-02 16:06 | - | |
| Daisenryaku 3 '90/ | 2018-01-02 16:06 | - | |
| Darius/ | 2018-01-02 16:06 | - | |
| Darius 2/ | 2018-01-02 16:06 | - | |
| Darius Gaiden/ | 2018-01-02 16:06 | - | |
| Death Bringer/ | 2018-01-02 16:06 | - | |
| Detana Twinbee/ | 2018-01-02 16:06 | - | |
| Devil/ | 2018-01-02 16:06 | - | |
| Dig Dug/ | 2018-01-02 16:06 | - | |
| Dig Dug 2/ | 2018-01-02 16:06 | - | |
| Digital Devil Story/ | 2018-01-02 16:06 | - | |
| Donkey Kong/ | 2018-01-02 16:06 | - | |
| Donkey Kong Jr/ | 2018-01-02 16:06 | - | |
| Dragon Buster/ | 2018-01-02 16:06 | - | |
| Dragon Quest/ | 2018-01-02 16:06 | - | |
| Dragon Quest 2/ | 2018-01-02 16:06 | - | |
| Dragon Quest 3/ | 2018-01-02 16:06 | - | |
| Dragon Quest 4/ | 2018-01-02 16:06 | - | |
| Dragon Quest Assorted/ | 2018-01-02 16:06 | - | |
| Dragon Saber/ | 2018-01-02 16:06 | - | |
| Dragon Slayer 4 - Legacy Of The Wizard/ | 2018-01-02 16:06 | - | |
| Dragon Slayer 6/ | 2018-01-02 16:06 | - | |
| Dragon Spirit/ | 2018-01-02 16:06 | - | |
| Dynamite Dux/ | 2018-01-02 16:06 | - | |
| Emerald/ | 2018-01-02 16:06 | - | |
| Emerald Dragon (PC98)/ | 2018-01-02 16:06 | - | |
| Emerald Dragon (X68)/ | 2018-01-02 16:06 | - | |
| Euphory/ | 2018-01-02 16:06 | - | |
| Excitebike/ | 2018-01-02 16:06 | - | |
| Exes/ | 2018-01-02 16:06 | - | |
| F1 Spirit/ | 2018-01-02 16:06 | - | |
| Famicom Disk System BIOS/ | 2018-01-02 16:06 | - | |
| Family Basic/ | 2018-01-02 16:06 | - | |
| Fantasy Zone/ | 2018-01-02 16:06 | - | |
| Final Fantasy 1/ | 2018-01-02 16:06 | - | |
| Final Fantasy 2/ | 2018-01-02 16:06 | - | |
| Final Fantasy 3/ | 2018-01-02 16:06 | - | |
| Final Fantasy 4/ | 2018-01-02 16:06 | - | |
| Final Fantasy 5/ | 2018-01-02 16:06 | - | |
| Final Zone/ | 2018-01-02 16:06 | - | |
| Final Zone Axis/ | 2018-01-02 16:06 | - | |
| Flak Attack/ | 2018-01-02 16:06 | - | |
| Flappy/ | 2018-01-02 16:06 | - | |
| Flicky/ | 2018-01-02 16:06 | - | |
| Full Throttle/ | 2018-01-02 16:06 | - | |
| G-Loc/ | 2018-01-02 16:06 | - | |
| GJ/ | 2018-01-02 16:06 | - | |
| Galaga '88/ | 2018-01-02 16:06 | - | |
| Galaga/ | 2018-01-02 16:06 | - | |
| Galaga PC88/ | 2018-01-02 16:06 | - | |
| Galaxian 3/ | 2018-01-02 16:06 | - | |
| Galaxy Force/ | 2018-01-02 16:06 | - | |
| Gamma Planet/ | 2018-01-02 16:06 | - | |
| Gauntlet/ | 2018-01-02 16:06 | - | |
| Genocide/ | 2018-01-02 16:06 | - | |
| Genocide 2/ | 2018-01-02 16:06 | - | |
| Genpei Toumaden/ | 2018-01-02 16:06 | - | |
| Goemon/ | 2018-01-02 16:06 | - | |
| Gofer/ | 2018-01-02 16:06 | - | |
| Goonies/ | 2018-01-02 16:06 | - | |
| Goonies 2/ | 2018-01-02 16:06 | - | |
| Gradius/ | 2018-01-02 16:06 | - | |
| Gradius 2 (Arcade)/ | 2018-01-02 16:06 | - | |
| Gradius 2 (Famicom)/ | 2018-01-02 16:06 | - | |
| Gradius 2 (MSX)/ | 2018-01-02 16:06 | - | |
| Gradius 2/ | 2018-01-02 16:06 | - | |
| Gradius 3/ | 2018-01-02 16:06 | - | |
| Granada/ | 2018-01-02 16:06 | - | |
| Green Beret/ | 2018-01-02 16:06 | - | |
| Gulkave/ | 2018-01-02 16:06 | - | |
| Halley's Comet/ | 2018-01-02 16:06 | - | |
| Hangon/ | 2018-01-02 16:06 | - | |
| Hattori-Kun/ | 2018-01-02 16:06 | - | |
| Hell Hound/ | 2018-01-02 16:06 | - | |
| Hex125/ | 2018-01-02 16:06 | - | |
| Hi No Tori/ | 2018-01-02 16:06 | - | |
| Hokuto No Ken/ | 2018-01-02 16:06 | - | |
| Hydlide (Famicom)/ | 2018-01-02 16:06 | - | |
| Hydlide 3/ | 2018-01-02 16:06 | - | |
| Hydlide 3 X1/ | 2018-01-02 16:06 | - | |
| Illumination Laser/ | 2018-01-02 16:06 | - | |
| Image Fight/ | 2018-01-02 16:06 | - | |
| In Focus/ | 2018-01-02 16:06 | - | |
| Inindou - Datou Nobunaga/ | 2018-01-02 16:06 | - | |
| Jesus/ | 2018-01-02 16:06 | - | |
| Jesus 2/ | 2018-01-02 16:06 | - | |
| Kagami/ | 2018-01-02 16:06 | - | |
| Kamishimo Records/ | 2018-01-02 16:07 | - | |
| Karateka/ | 2018-01-02 16:07 | - | |
| King's Valley/ | 2018-01-02 16:07 | - | |
| King Kong 2/ | 2018-01-02 16:07 | - | |
| Knight Arms/ | 2018-01-02 16:07 | - | |
| Kohaku Shoku No Yuigon/ | 2018-01-02 16:07 | - | |
| Kou Ryuu Ki/ | 2018-01-02 16:07 | - | |
| Kyuukyoku Tiger/ | 2018-01-02 16:07 | - | |
| L'Empereur/ | 2018-01-02 16:07 | - | |
| Lagoon/ | 2018-01-02 16:07 | - | |
| Last Armageddon/ | 2018-01-02 16:07 | - | |
| Latpick/ | 2018-01-02 16:07 | - | |
| Laydock/ | 2018-01-02 16:07 | - | |
| Legend Of Valkyrie/ | 2018-01-02 16:07 | - | |
| Lemmings/ | 2018-01-02 16:07 | - | |
| Libble Rabble/ | 2018-01-02 16:07 | - | |
| Link's Adventure/ | 2018-01-02 16:07 | - | |
| Lode Runner/ | 2018-01-02 16:07 | - | |
| Luxsor/ | 2018-01-02 16:07 | - | |
| MVP/ | 2018-01-02 16:07 | - | |
| Macross/ | 2018-01-02 16:07 | - | |
| Mad Stalker/ | 2018-01-02 16:07 | - | |
| Mado/ | 2018-01-02 16:07 | - | |
| Majou Oukoku/ | 2018-01-02 16:07 | - | |
| Makaimura/ | 2018-01-02 16:07 | - | |
| Makaimura 2/ | 2018-01-02 16:07 | - | |
| Mappy/ | 2018-01-02 16:07 | - | |
| Marble Madness/ | 2018-01-02 16:07 | - | |
| Marchen Maze/ | 2018-01-02 16:07 | - | |
| Mario Brothers/ | 2018-01-02 16:07 | - | |
| Marvel Land/ | 2018-01-02 16:07 | - | |
| Maze Of Galious/ | 2018-01-02 16:07 | - | |
| Metal Black/ | 2018-01-02 16:07 | - | |
| Metal Gear 2/ | 2018-01-02 16:07 | - | |
| Metal Hawk (Alt)/ | 2018-01-02 16:07 | - | |
| Metal Hawk/ | 2018-01-02 16:07 | - | |
| Metal Sight/ | 2018-01-02 16:07 | - | |
| Metro Cross/ | 2018-01-02 16:07 | - | |
| Metroid/ | 2018-01-02 16:07 | - | |
| Mezon/ | 2018-01-02 16:07 | - | |
| Mid Garts/ | 2018-01-02 16:07 | - | |
| Midnight Landing/ | 2018-01-02 16:07 | - | |
| Midnight Resistance/ | 2018-01-02 16:07 | - | |
| Midnight Scramble/ | 2018-01-02 16:07 | - | |
| Milon's Secret Castle/ | 2018-01-02 16:07 | - | |
| Misty/ | 2018-01-02 16:07 | - | |
| Mixed/ | 2018-01-02 16:07 | - | |
| Moero Twinbee/ | 2018-01-02 16:07 | - | |
| Momotarou Densetsu/ | 2018-01-02 16:07 | - | |
| Monster Land/ | 2018-01-02 16:07 | - | |
| Moon Cresta/ | 2018-01-02 16:07 | - | |
| Moonlight/ | 2018-01-02 16:07 | - | |
| Motos/ | 2018-01-02 16:07 | - | |
| Mule/ | 2018-01-02 16:07 | - | |
| Murder Club DX/ | 2018-01-02 16:07 | - | |
| Nama/ | 2018-01-02 16:07 | - | |
| Nekketsu Koukou Dodgeball Bu/ | 2018-01-02 16:07 | - | |
| Neural Gear/ | 2018-01-02 16:07 | - | |
| New Zealand Story/ | 2018-01-02 16:07 | - | |
| Night Stalker/ | 2018-01-02 16:07 | - | |
| Ninja Kage/ | 2018-01-02 16:07 | - | |
| Ninja Warriors/ | 2018-01-02 16:07 | - | |
| Nobunaga No Yabou - Boshou Fuunroku/ | 2018-01-02 16:07 | - | |
| Nobunaga No Yabou - Haouden/ | 2018-01-02 16:07 | - | |
| Nobunaga No Yabou - Sengoku Gunyuuden/ | 2018-01-02 16:07 | - | |
| Nobunaga No Yabou - Zenkokuban (PC88)/ | 2018-01-02 16:07 | - | |
| Nobunaga No Yabou - Zenkokuban (X68)/ | 2018-01-02 16:07 | - | |
| Nostal/ | 2018-01-02 16:07 | - | |
| Nuts And Milk/ | 2018-01-02 16:07 | - | |
| Oh! Hajiki!/ | 2018-01-02 16:07 | - | |
| Okhotsk Ni Kiyu/ | 2018-01-02 16:07 | - | |
| Ora/ | 2018-01-02 16:07 | - | |
| Ordynes/ | 2018-01-02 16:07 | - | |
| Ougon No Shiro/ | 2018-01-02 16:07 | - | |
| Outrun/ | 2018-01-02 16:07 | - | |
| Overtake/ | 2018-01-02 16:07 | - | |
| Pac Land/ | 2018-01-02 16:07 | - | |
| Pac Man/ | 2018-01-02 16:07 | - | |
| Pac Mania/ | 2018-01-02 16:07 | - | |
| Parodius Da! (Arcade)/ | 2018-01-02 16:07 | - | |
| Parodius Da! (X68)/ | 2018-01-02 16:07 | - | |
| Phalanx/ | 2018-01-02 16:07 | - | |
| Phelios/ | 2018-01-02 16:07 | - | |
| Pippols/ | 2018-01-02 16:07 | - | |
| Pole Position/ | 2018-01-02 16:07 | - | |
| Popeye/ | 2018-01-02 16:07 | - | |
| Popful Mail/ | 2018-01-02 16:07 | - | |
| Populus/ | 2018-01-02 16:07 | - | |
| Prince Of Persia/ | 2018-01-02 16:07 | - | |
| Psyo/ | 2018-01-02 16:07 | - | |
| Pulirula/ | 2018-01-02 16:07 | - | |
| Puyo Puyo/ | 2018-01-02 16:07 | - | |
| Qbert/ | 2018-01-02 16:07 | - | |
| Quartet (alternative)/ | 2018-01-02 16:07 | - | |
| Quartet/ | 2018-01-02 16:07 | - | |
| Quartet 2/ | 2018-01-02 16:07 | - | |
| Quarth/ | 2018-01-02 16:07 | - | |
| R-Type/ | 2018-01-02 16:07 | - | |
| R-Type 2/ | 2018-01-02 16:07 | - | |
| RW/ | 2018-01-02 16:07 | - | |
| Rainbow Islands/ | 2018-01-02 16:07 | - | |
| Rayforce/ | 2018-01-02 16:07 | - | |
| Relics/ | 2018-01-02 16:07 | - | |
| Return Of Ishtar/ | 2018-01-02 16:07 | - | |
| Revenge Of Barusa/ | 2018-01-02 16:07 | - | |
| Rock N Rope/ | 2018-01-02 16:07 | - | |
| Rolling Thunder/ | 2018-01-02 16:07 | - | |
| Rolling Thunder 2/ | 2018-01-02 16:07 | - | |
| Romancia/ | 2018-01-02 16:07 | - | |
| Romancing Saga/ | 2018-01-02 16:07 | - | |
| Rune/ | 2018-01-02 16:07 | - | |
| SDI/ | 2018-01-02 16:07 | - | |
| Sa-Zi-Ri/ | 2018-01-02 16:07 | - | |
| Saigo No Shinobu Michi/ | 2018-01-02 16:07 | - | |
| Salamander/ | 2018-01-02 16:07 | - | |
| Sangokushi/ | 2018-01-02 16:07 | - | |
| Sangokushi 2/ | 2018-01-02 16:07 | - | |
| Sangokushi 3/ | 2018-01-02 16:07 | - | |
| Scheme/ | 2018-01-02 16:07 | - | |
| Seirane/ | 2018-01-02 16:07 | - | |
| Senjou No Ookami/ | 2018-01-02 16:07 | - | |
| Shin Onigashima/ | 2018-01-02 16:07 | - | |
| Shinnyuu Shain Tooru Kun/ | 2018-01-02 16:07 | - | |
| Shooting 68000/ | 2018-01-02 16:07 | - | |
| Shufflepuck Cafe/ | 2018-01-02 16:07 | - | |
| Side Pocket/ | 2018-01-02 16:07 | - | |
| Silent/ | 2018-01-02 16:07 | - | |
| Silk 2/ | 2018-01-02 16:07 | - | |
| Silpheed/ | 2018-01-02 16:07 | - | |
| Sion/ | 2018-01-02 16:07 | - | |
| Sion 2/ | 2018-01-02 16:07 | - | |
| Sky Kid/ | 2018-01-02 16:07 | - | |
| Slapfight/ | 2018-01-02 16:07 | - | |
| Snatcher/ | 2018-01-02 16:07 | - | |
| Sol Feace/ | 2018-01-02 16:07 | - | |
| Sonic Boom/ | 2018-01-02 16:07 | - | |
| Sonic The Hedgehog (alternative)/ | 2018-01-02 16:07 | - | |
| Sonic The Hedgehog/ | 2018-01-02 16:07 | - | |
| Sorcerian (Megadrive)/ | 2018-01-02 16:07 | - | |
| Sorcerian (PC88)/ | 2018-01-02 16:07 | - | |
| Sorcerian/ | 2018-01-02 16:07 | - | |
| Sorcerian 2/ | 2018-01-02 16:07 | - | |
| Sorcerian X1/ | 2018-01-02 16:07 | - | |
| Space Harrier (X68)/ | 2018-01-02 16:07 | - | |
| Space Harrier/ | 2018-01-02 16:07 | - | |
| Spellbound/ | 2018-01-02 16:07 | - | |
| Spelunker/ | 2018-01-02 16:07 | - | |
| Star Blade/ | 2018-01-02 16:07 | - | |
| Star Cruiser (SB2)/ | 2018-01-02 16:07 | - | |
| Star Cruiser/ | 2018-01-02 16:07 | - | |
| Star Force/ | 2018-01-02 16:07 | - | |
| Star Lus/ | 2018-01-02 16:07 | - | |
| Star Pulse/ | 2018-01-02 16:07 | - | |
| Star Soldier/ | 2018-01-02 16:07 | - | |
| Star Wars/ | 2018-01-02 16:07 | - | |
| Street Fighter 2/ | 2018-01-02 16:07 | - | |
| Strider Hiryu/ | 2018-01-02 16:07 | - | |
| Suikoden - Tenmei No Chikai/ | 2018-01-02 16:07 | - | |
| Super Contra/ | 2018-01-02 16:07 | - | |
| Super Daisenryaku/ | 2018-01-02 16:07 | - | |
| Super Hangon (Megadrive)/ | 2018-01-02 16:07 | - | |
| Super Hangon/ | 2018-01-02 16:07 | - | |
| Super Laydock/ | 2018-01-02 16:07 | - | |
| Super Laydock X1/ | 2018-01-02 16:07 | - | |
| Super Mario Bros/ | 2018-01-02 16:07 | - | |
| Super Star Force/ | 2018-01-02 16:07 | - | |
| Super Street Fighter 2/ | 2018-01-02 16:07 | - | |
| Syvalion/ | 2018-01-02 16:07 | - | |
| Taikou Risshiden/ | 2018-01-02 16:07 | - | |
| Tatakai No Banka/ | 2018-01-02 16:07 | - | |
| Tc2m/ | 2018-01-02 16:07 | - | |
| Teitoku No Ketsudan/ | 2018-01-02 16:07 | - | |
| Tenchi Muyo/ | 2018-01-02 16:07 | - | |
| Tenka Toitsu/ | 2018-01-02 16:07 | - | |
| Tetris (Arcade)/ | 2018-01-02 16:07 | - | |
| Tetris/ | 2018-01-02 16:07 | - | |
| The Man I Love/ | 2018-01-02 16:07 | - | |
| Thexder/ | 2018-01-02 16:07 | - | |
| Thunder Blade/ | 2018-01-02 16:07 | - | |
| Thunder Cross (alternative)/ | 2018-01-02 16:07 | - | |
| Thunder Cross/ | 2018-01-02 16:07 | - | |
| Thunder Force 2/ | 2018-01-02 16:07 | - | |
| Thunder Force 2 Arrange/ | 2018-01-02 16:07 | - | |
| Thunder Force 3/ | 2018-01-02 16:07 | - | |
| Thunder Force 4/ | 2018-01-02 16:07 | - | |
| Thunder Scepter/ | 2018-01-02 16:07 | - | |
| Toki/ | 2018-01-02 16:07 | - | |
| Tokushu Butai Jackal/ | 2018-01-02 16:07 | - | |
| Top Landing/ | 2018-01-02 16:07 | - | |
| Toritoon/ | 2018-01-02 16:07 | - | |
| Tower Of Babel/ | 2018-01-02 16:07 | - | |
| Tower Of Druaga/ | 2018-01-02 16:07 | - | |
| Treasure Of Usas/ | 2018-01-02 16:07 | - | |
| Tsu Ryu/ | 2018-01-02 16:07 | - | |
| Twinbee/ | 2018-01-02 16:07 | - | |
| Tyb/ | 2018-01-02 16:07 | - | |
| US Navy Fighters/ | 2018-01-02 16:07 | - | |
| Urban Champion/ | 2018-01-02 16:07 | - | |
| Valis 2 - Phantasm Soldier/ | 2018-01-02 16:07 | - | |
| Verytex/ | 2018-01-02 16:07 | - | |
| View Point/ | 2018-01-02 16:07 | - | |
| Virtua Racing/ | 2018-01-02 16:07 | - | |
| Volfied 2/ | 2018-01-02 16:07 | - | |
| Wan Puku Athletic/ | 2018-01-02 16:07 | - | |
| Wecleman/ | 2018-01-02 16:07 | - | |
| Wizardry 2/ | 2018-01-02 16:07 | - | |
| Wrecking Crew/ | 2018-01-02 16:07 | - | |
| Wrestle Ball/ | 2018-01-02 16:07 | - | |
| Xak/ | 2018-01-02 16:07 | - | |
| Xanadu (MSX)/ | 2018-01-02 16:07 | - | |
| Xanadu/ | 2018-01-02 16:07 | - | |
| Xanadu Scenario 2/ | 2018-01-02 16:07 | - | |
| Xanadu X1/ | 2018-01-02 16:07 | - | |
| Xevious/ | 2018-01-02 16:07 | - | |
| Xexex/ | 2018-01-02 16:07 | - | |
| Xzr/ | 2018-01-02 16:07 | - | |
| Yaksa/ | 2018-01-02 16:07 | - | |
| Yie Ar Kung-Fu/ | 2018-01-02 16:07 | - | |
| Yosaku/ | 2018-01-02 16:07 | - | |
| Ys (MSX)/ | 2018-01-02 16:07 | - | |
| Ys (PC88)/ | 2018-01-02 16:07 | - | |
| Ys/ | 2018-01-02 16:07 | - | |
| Ys 2 (PC88)/ | 2018-01-02 16:07 | - | |
| Ys 2/ | 2018-01-02 16:07 | - | |
| Ys 2 X1/ | 2018-01-02 16:07 | - | |
| Ys 3/ | 2018-01-02 16:07 | - | |
| Yume Tairiku Adventure/ | 2018-01-02 16:07 | - | |
| Zan - Kagerou No Jidai/ | 2018-01-02 16:07 | - | |
| Zanac/ | 2018-01-02 16:07 | - | |
| Zavas/ | 2018-01-02 16:07 | - | |
| Zelda/ | 2018-01-02 16:07 | - | |
| Zeliard (Pi)/ | 2018-01-02 16:07 | - | |
| Zeliard/ | 2018-01-02 16:07 | - | |
| Zugya/ | 2018-01-02 16:07 | - | |