![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| forgotmx.xm | 2008-07-03 17:58 | 11M | |
| physical reaction.xm | 2008-07-03 17:58 | 3.0M | |
| mystery man.xm | 2008-07-03 17:58 | 2.6M | |
| colors of dreams.xm | 2008-07-03 17:56 | 2.5M | |
| towards the sun.xm | 2008-07-03 17:59 | 2.2M | |
| yellow light ii.xm | 2008-07-03 17:59 | 1.9M | |
| night life.xm | 2008-07-03 17:58 | 1.8M | |
| to wake the spirits.xm | 2008-07-03 17:58 | 1.7M | |
| release.xm | 2008-07-03 17:58 | 1.6M | |
| temple of souls.xm | 2008-07-03 17:58 | 1.4M | |
| no light.xm | 2008-07-03 17:58 | 1.4M | |
| for one day revived.xm | 2008-07-03 17:56 | 1.2M | |
| distant view.xm | 2008-07-03 17:56 | 1.1M | |
| water reflection.xm | 2008-07-03 17:59 | 1.0M | |
| the forgotten name.xm | 2008-07-03 17:58 | 950K | |
| 15 billion years.xm | 2008-07-03 17:56 | 833K | |
| second degree.xm | 2008-07-03 17:58 | 763K | |
| a spring song.xm | 2008-07-03 17:56 | 739K | |
| we are the phuture.xm | 2008-07-03 17:59 | 346K | |
| ambient controls.xm | 2008-07-03 17:56 | 319K | |
| the gate.xm | 2008-07-03 17:58 | 121K | |
| be a machine.xm | 2008-07-03 17:56 | 119K | |
| coop-Moonblaster/ | 2008-07-03 17:59 | - | |