![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| you're never alone.xm | 2008-07-03 09:33 | 1.8M | |
| why don't you dance with me.xm | 2008-07-03 09:33 | 800K | |
| voyagers.xm | 2008-07-03 09:33 | 1.7M | |
| visions.xm | 2008-07-03 09:33 | 1.0M | |
| tirol.xm | 2008-07-03 09:33 | 511K | |
| the identical moment.xm | 2008-07-03 09:33 | 1.7M | |
| the dreamer.xm | 2008-07-03 09:33 | 904K | |
| recording.xm | 2008-07-03 09:33 | 3.6M | |
| open your eyes[inst].xm | 2008-07-03 09:32 | 1.1M | |
| neologicsep.the.beat.xm | 2008-07-03 09:32 | 856K | |
| love generation.xm | 2008-07-03 09:32 | 1.0M | |
| loud and clear.xm | 2008-07-03 09:32 | 1.0M | |
| in my mind.xm | 2008-07-03 09:32 | 6.2M | |
| illusions ep track 1.xm | 2008-07-03 09:31 | 664K | |
| go solo!.xm | 2008-07-03 09:31 | 509K | |
| goabox 1-drifting edit.xm | 2008-07-03 09:31 | 932K | |
| follow me.xm | 2008-07-03 09:31 | 972K | |
| flying.xm | 2008-07-03 09:31 | 1.2M | |
| echoes.xm | 2008-07-03 09:31 | 1.3M | |
| deal with the problem.xm | 2008-07-03 09:31 | 958K | |
| cosmic voices.xm | 2008-07-03 09:31 | 3.9M | |
| chemical movement.xm | 2008-07-03 09:31 | 692K | |
| basic theme no1 rmx.xm | 2008-07-03 09:31 | 1.1M | |
| 4channelboom!.xm | 2008-07-03 09:30 | 236K | |