| ![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description | 
|---|---|---|---|---|
| ![[PARENTDIR]](/icons/back.gif) | Parent Directory | - | ||
| ![[   ]](/icons/unknown.gif) | wicked.sndh | 2023-12-30 05:17 | 2.5K | |
| ![[   ]](/icons/unknown.gif) | what time is it - scrolly.sndh | 2023-12-30 05:17 | 1.7K | |
| ![[   ]](/icons/unknown.gif) | what time is it - main menu.sndh | 2023-12-30 05:17 | 6.3K | |
| ![[   ]](/icons/unknown.gif) | what time is it - bouncy.sndh | 2023-12-30 05:17 | 2.4K | |
| ![[   ]](/icons/unknown.gif) | vortex.sndh | 2023-12-30 05:17 | 5.8K | |
| ![[   ]](/icons/unknown.gif) | twilight beyond.sndh | 2023-12-30 05:17 | 3.3K | |
| ![[   ]](/icons/unknown.gif) | traffic.sndh | 2023-12-30 05:17 | 2.8K | |
| ![[   ]](/icons/unknown.gif) | structure.sndh | 2023-12-30 05:17 | 2.4K | |
| ![[   ]](/icons/unknown.gif) | sticks.sndh | 2023-12-30 05:17 | 6.3K | |
| ![[   ]](/icons/unknown.gif) | stand by.sndh | 2023-12-30 05:17 | 3.4K | |
| ![[   ]](/icons/unknown.gif) | sanxion loader digi.sndh | 2023-12-30 05:17 | 5.2K | |
| ![[   ]](/icons/unknown.gif) | sanxion loader.sndh | 2023-12-30 05:17 | 3.0K | |
| ![[   ]](/icons/unknown.gif) | reality.sndh | 2023-12-30 05:17 | 7.2K | |
| ![[   ]](/icons/unknown.gif) | pym - sickest so far.sndh | 2023-12-30 05:17 | 2.7K | |
| ![[   ]](/icons/unknown.gif) | pym - main menu.sndh | 2023-12-30 05:17 | 2.5K | |
| ![[   ]](/icons/unknown.gif) | pym - loader.sndh | 2023-12-30 05:17 | 2.2K | |
| ![[   ]](/icons/unknown.gif) | pym - isido way of stones.sndh | 2023-12-30 05:17 | 2.7K | |
| ![[   ]](/icons/unknown.gif) | pym - intro (prime time).sndh | 2023-12-30 05:17 | 2.6K | |
| ![[   ]](/icons/unknown.gif) | pym - copperkaahbaahnaah.sndh | 2023-12-30 05:17 | 3.1K | |
| ![[   ]](/icons/unknown.gif) | pym - colours go bang.sndh | 2023-12-30 05:17 | 2.7K | |
| ![[   ]](/icons/unknown.gif) | pym - change disks.sndh | 2023-12-30 05:17 | 2.9K | |
| ![[   ]](/icons/unknown.gif) | pym - best part of creation.sndh | 2023-12-30 05:17 | 2.7K | |
| ![[   ]](/icons/unknown.gif) | pursuit 2.sndh | 2023-12-30 05:17 | 6.1K | |
| ![[   ]](/icons/unknown.gif) | pursuit.sndh | 2023-12-30 05:17 | 6.2K | |
| ![[   ]](/icons/unknown.gif) | prophecy (st news 11.1).sndh | 2023-12-30 05:17 | 11K | |
| ![[   ]](/icons/unknown.gif) | poppycock - stars.sndh | 2023-12-30 05:17 | 1.8K | |
| ![[   ]](/icons/unknown.gif) | poppycock - sprites.sndh | 2023-12-30 05:17 | 2.1K | |
| ![[   ]](/icons/unknown.gif) | poppycock - intro.sndh | 2023-12-30 05:17 | 2.2K | |
| ![[   ]](/icons/unknown.gif) | offbeat.sndh | 2023-12-30 05:17 | 2.2K | |
| ![[   ]](/icons/unknown.gif) | no second prize.sndh | 2023-12-30 05:17 | 11K | |
| ![[   ]](/icons/unknown.gif) | musical wonder.sndh | 2023-12-30 05:17 | 3.0K | |
| ![[   ]](/icons/unknown.gif) | melancho.sndh | 2023-12-30 05:17 | 6.0K | |
| ![[   ]](/icons/unknown.gif) | magick.sndh | 2023-12-30 05:17 | 5.6K | |
| ![[   ]](/icons/unknown.gif) | locomotion.sndh | 2023-12-30 05:17 | 7.9K | |
| ![[   ]](/icons/unknown.gif) | killer digi.sndh | 2023-12-30 05:17 | 4.0K | |
| ![[   ]](/icons/unknown.gif) | killer.sndh | 2023-12-30 05:17 | 2.6K | |
| ![[   ]](/icons/unknown.gif) | judgement day (st news 7.2).sndh | 2023-12-30 05:17 | 3.7K | |
| ![[   ]](/icons/unknown.gif) | jazz.sndh | 2023-12-30 05:17 | 5.5K | |
| ![[   ]](/icons/unknown.gif) | high gear.sndh | 2023-12-30 05:17 | 5.4K | |
| ![[   ]](/icons/unknown.gif) | galaxy.sndh | 2023-12-30 05:17 | 6.5K | |
| ![[   ]](/icons/unknown.gif) | feardrop.sndh | 2023-12-30 05:17 | 2.4K | |
| ![[   ]](/icons/unknown.gif) | crystal clear (mega leif).sndh | 2023-12-30 05:17 | 2.9K | |
| ![[   ]](/icons/unknown.gif) | bangkok knights loader.sndh | 2023-12-30 05:17 | 6.2K | |
| ![[   ]](/icons/unknown.gif) | action.sndh | 2023-12-30 05:17 | 5.8K | |
| ![[   ]](/icons/unknown.gif) | a case for two.sndh | 2023-12-30 05:17 | 2.5K | |